EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H32N4O7 |
| Net Charge | -2 |
| Average Mass | 596.640 |
| Monoisotopic Mass | 596.22820 |
| SMILES | C=CC1=C(C)C(=O)N/C1=C\c1nc(C(=O)c2nc(/C=C3\NC(=O)C(C)=C3CCC(=O)[O-])c(CCC(=O)[O-])c2C)c(C=C)c1C |
| InChI | InChI=1S/C33H34N4O7/c1-7-19-17(5)32(43)36-24(19)13-23-15(3)20(8-2)30(34-23)31(42)29-16(4)21(9-11-27(38)39)25(35-29)14-26-22(10-12-28(40)41)18(6)33(44)37-26/h7-8,13-14,34-35H,1-2,9-12H2,3-6H3,(H,36,43)(H,37,44)(H,38,39)(H,40,41)/p-2/b24-13-,26-14- |
| InChIKey | PKYGGJJSPHKEPX-SOSDAJRSSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-oxo-δ-bilirubin(2−) (CHEBI:74361) is a dicarboxylic acid dianion (CHEBI:28965) |
| 5-oxo-δ-bilirubin(2−) (CHEBI:74361) is a linear tetrapyrrole anion (CHEBI:59252) |
| 5-oxo-δ-bilirubin(2−) (CHEBI:74361) is conjugate base of 5-oxo-δ-bilirubin (CHEBI:74621) |
| Incoming Relation(s) |
| 5-oxo-δ-bilirubin (CHEBI:74621) is conjugate acid of 5-oxo-δ-bilirubin(2−) (CHEBI:74361) |
| Synonym | Source |
|---|---|
| 10-oxo-δ-bilirubin(2−) | ChEBI |
| UniProt Name | Source |
|---|---|
| δ-staphylobilin | UniProt |
| Citations |
|---|