EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15N3O3 |
| Net Charge | 0 |
| Average Mass | 213.237 |
| Monoisotopic Mass | 213.11134 |
| SMILES | CCCC[C@H](N/C([O-])=C/[N+]#N)C(=O)OC |
| InChI | InChI=1S/C9H15N3O3/c1-3-4-5-7(9(14)15-2)12-8(13)6-11-10/h6-7,12H,3-5H2,1-2H3/b8-6-/t7-/m0/s1 |
| InChIKey | MKAAKOISGFVECA-VQKCLUMFSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-diazoacetylnorleucine methyl ester (CHEBI:74350) has role metabolite (CHEBI:25212) |
| N-diazoacetylnorleucine methyl ester (CHEBI:74350) is a diazonium betaine (CHEBI:75519) |
| N-diazoacetylnorleucine methyl ester (CHEBI:74350) is a methyl ester (CHEBI:25248) |
| IUPAC Name |
|---|
| (Z)-2-diazonio-1-{[(2S)-1-methoxy-1-oxohexan-2-yl]amino}ethenolate |