EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18N2O5 |
| Net Charge | 0 |
| Average Mass | 246.263 |
| Monoisotopic Mass | 246.12157 |
| SMILES | CC(C)C[C@H](N)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H18N2O5/c1-5(2)3-6(11)9(15)12-7(10(16)17)4-8(13)14/h5-7H,3-4,11H2,1-2H3,(H,12,15)(H,13,14)(H,16,17)/t6-,7-/m0/s1 |
| InChIKey | DVCSNHXRZUVYAM-BQBZGAKWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leu-Asp (CHEBI:74332) has role metabolite (CHEBI:25212) |
| Leu-Asp (CHEBI:74332) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-leucyl-L-aspartic acid |
| Synonyms | Source |
|---|---|
| LD | ChEBI |
| Leucyl-Aspartate | HMDB |
| leucylaspartic acid | ChEBI |
| L-Leu-L-Asp | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028925 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1728618 | Reaxys |