EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H23N3O6 |
| Net Charge | 0 |
| Average Mass | 329.353 |
| Monoisotopic Mass | 329.15869 |
| SMILES | COC(=O)/C=C/C(=O)NCC(N)C(=O)N[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C14H23N3O6/c1-8(2)6-10(14(21)22)17-13(20)9(15)7-16-11(18)4-5-12(19)23-3/h4-5,8-10H,6-7,15H2,1-3H3,(H,16,18)(H,17,20)(H,21,22)/b5-4+/t9?,10-/m0/s1 |
| InChIKey | WMRULULWXGOKDR-VVMSLXPCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leu-FMDP (CHEBI:74323) has functional parent L-leucine (CHEBI:15603) |
| Leu-FMDP (CHEBI:74323) has functional parent 3-aminoalanine (CHEBI:18383) |
| Leu-FMDP (CHEBI:74323) has role metabolite (CHEBI:25212) |
| Leu-FMDP (CHEBI:74323) is a dipeptide (CHEBI:46761) |
| Leu-FMDP (CHEBI:74323) is a methyl ester (CHEBI:25248) |
| IUPAC Name |
|---|
| 3-{[(2E)-4-methoxy-4-oxobut-2-enoyl]amino}alanyl-L-leucine |
| Manual Xrefs | Databases |
|---|---|
| CPD0-1906 | MetaCyc |