EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H27NO4 |
| Net Charge | 0 |
| Average Mass | 273.373 |
| Monoisotopic Mass | 273.19401 |
| SMILES | CCCCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C14H27NO4/c1-5-6-7-8-9-14(18)19-12(10-13(16)17)11-15(2,3)4/h12H,5-11H2,1-4H3 |
| InChIKey | VDPCTFWULDLKHT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-heptanoylcarnitine (CHEBI:74303) has functional parent heptanoic acid (CHEBI:45571) |
| O-heptanoylcarnitine (CHEBI:74303) has role metabolite (CHEBI:25212) |
| O-heptanoylcarnitine (CHEBI:74303) is a O-acylcarnitine (CHEBI:17387) |
| O-heptanoylcarnitine (CHEBI:74303) is a ammonium betaine (CHEBI:35284) |
| O-heptanoylcarnitine (CHEBI:74303) is a carboxylic ester (CHEBI:33308) |
| IUPAC Name |
|---|
| 3-(heptanoyloxy)-4-(trimethylammonio)butanoate |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013238 | HMDB |