EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O |
| Net Charge | 0 |
| Average Mass | 290.491 |
| Monoisotopic Mass | 290.26097 |
| SMILES | C=CC(C)(O)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C20H34O/c1-7-20(6,21)16-10-15-19(5)14-9-13-18(4)12-8-11-17(2)3/h7,11,13,15,21H,1,8-10,12,14,16H2,2-6H3/b18-13+,19-15+ |
| InChIKey | IQDXAJNQKSIPGB-HQSZAHFGSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.3.1.50 (serine C-palmitoyltransferase) inhibitor An EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor that interferes with the action of serine palmitoyltransferase (EC 2.3.1.50). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| geranyllinalool (CHEBI:74299) has role EC 2.3.1.50 (serine C-palmitoyltransferase) inhibitor (CHEBI:59647) |
| geranyllinalool (CHEBI:74299) has role fragrance (CHEBI:48318) |
| geranyllinalool (CHEBI:74299) has role metabolite (CHEBI:25212) |
| geranyllinalool (CHEBI:74299) is a diterpenoid (CHEBI:23849) |
| geranyllinalool (CHEBI:74299) is a tertiary alcohol (CHEBI:26878) |
| Incoming Relation(s) |
| lyciumoside II (CHEBI:133834) has functional parent geranyllinalool (CHEBI:74299) |
| IUPAC Name |
|---|
| (6E,10E)-3,7,11,15-tetramethylhexadeca-1,6,10,14-tetraen-3-ol |
| Synonyms | Source |
|---|---|
| 3,7,11,15-Tetramethyl-1,6,10,14-hexadecatetraen-3-ol | ChemIDplus |
| (E,E)-3,7,11,15-tetramethylhexadeca-1,6,10,14-tetraen-3-ol | NIST Chemistry WebBook |
| (E,E)-geranyllinalool | MetaCyc |
| Geranyl linalool | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (6E,10E)-geranyllinalool | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CN101070270 | Patent |
| CPD-8848 | MetaCyc |
| Citations |
|---|