EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12O6 |
| Net Charge | 0 |
| Average Mass | 276.244 |
| Monoisotopic Mass | 276.06339 |
| SMILES | Cc1cc(O)cc(O)c1C(=O)Cc1cc(O)cc(=O)o1 |
| InChI | InChI=1S/C14H12O6/c1-7-2-8(15)4-11(17)14(7)12(18)6-10-3-9(16)5-13(19)20-10/h2-5,15-17H,6H2,1H3 |
| InChIKey | JIBVOQAUTOPGPH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-[2-(2,4-dihydroxy-6-methylphenyl)-2-oxoethyl]-4-hydroxy-pyran-2-one (CHEBI:74295) has functional parent 2H-pyran-2-one (CHEBI:37965) |
| 6-[2-(2,4-dihydroxy-6-methylphenyl)-2-oxoethyl]-4-hydroxy-pyran-2-one (CHEBI:74295) has role metabolite (CHEBI:25212) |
| 6-[2-(2,4-dihydroxy-6-methylphenyl)-2-oxoethyl]-4-hydroxy-pyran-2-one (CHEBI:74295) is a 2-pyranones (CHEBI:75885) |
| 6-[2-(2,4-dihydroxy-6-methylphenyl)-2-oxoethyl]-4-hydroxy-pyran-2-one (CHEBI:74295) is a polyketide (CHEBI:26188) |
| 6-[2-(2,4-dihydroxy-6-methylphenyl)-2-oxoethyl]-4-hydroxy-pyran-2-one (CHEBI:74295) is a resorcinols (CHEBI:33572) |
| IUPAC Name |
|---|
| 6-[2-(2,4-dihydroxy-6-methylphenyl)-2-oxoethyl]-4-hydroxy-2H-pyran-2-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23144242 | Reaxys |