EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H32N2O2 |
| Net Charge | 0 |
| Average Mass | 392.543 |
| Monoisotopic Mass | 392.24638 |
| SMILES | C[C@H](CN1CCOCC1)C(C(=O)N1CCCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H32N2O2/c1-21(20-26-16-18-29-19-17-26)25(22-10-4-2-5-11-22,23-12-6-3-7-13-23)24(28)27-14-8-9-15-27/h2-7,10-13,21H,8-9,14-20H2,1H3/t21-/m1/s1 |
| InChIKey | INUNXTSAACVKJS-OAQYLSRUSA-N |
| Roles Classification |
|---|
| Biological Role: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| Application: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dextromoramide (CHEBI:74274) has role opioid analgesic (CHEBI:35482) |
| dextromoramide (CHEBI:74274) is a N-acylpyrrolidine (CHEBI:46766) |
| dextromoramide (CHEBI:74274) is a morpholines (CHEBI:38785) |
| IUPAC Name |
|---|
| (3S)-3-methyl-4-(morpholin-4-yl)-2,2-diphenyl-1-(pyrrolidin-1-yl)butan-1-one |
| INNs | Source |
|---|---|
| dextromoramida | ChemIDplus |
| dextromoramide | ChemIDplus |
| dextromoramide | WHO MedNet |
| dextromoramidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| SKF-5137 | ChEBI |
| (+)-3-methyl-4-morpholino-2,2-diphenyl-1-(pyrrolidin-1-yl)butanone | ChEBI |
| (+)-2,2-diphenyl-3-methyl-4-morpholinobutyrylpyrrolidine | ChemIDplus |
| SKF 5137 | ChemIDplus |
| palphium | ChEBI |
| palfium | ChEBI |
| Citations |
|---|