EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H20N5O7P |
| Net Charge | 0 |
| Average Mass | 389.305 |
| Monoisotopic Mass | 389.11003 |
| SMILES | CO[C@H]1[C@@H](O)[C@H](n2cnc3c(=O)n(C)c(N)nc32)O[C@@H]1COP(C)(=O)O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N1-methylguanosine 5'-monophosphate residue (CHEBI:74267) is a nucleotide residue (CHEBI:50319) |
| N1-methylguanosine 5'-monophosphate residue (CHEBI:74267) is conjugate acid of N1-methylguanosine 5'-monophosphate(1−) residue (CHEBI:73542) |
| N1-methylguanosine 5'-monophosphate residue (CHEBI:74267) is substituent group from N1-methylguanosine 5'-monophosphate (CHEBI:74268) |
| Incoming Relation(s) |
| N1-methylguanosine 5'-monophosphate(1−) residue (CHEBI:73542) is conjugate base of N1-methylguanosine 5'-monophosphate residue (CHEBI:74267) |