EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9N3O4 |
| Net Charge | 0 |
| Average Mass | 163.133 |
| Monoisotopic Mass | 163.05931 |
| SMILES | NC(=O)NOC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C4H9N3O4/c5-2(3(8)9)1-11-7-4(6)10/h2H,1,5H2,(H,8,9)(H3,6,7,10)/t2-/m1/s1 |
| InChIKey | ZFLDWYJOQSXISF-UWTATZPHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-ureido-D-serine (CHEBI:74212) has role metabolite (CHEBI:25212) |
| O-ureido-D-serine (CHEBI:74212) is a D-serine derivative (CHEBI:84133) |
| O-ureido-D-serine (CHEBI:74212) is a D-α-amino acid (CHEBI:16733) |
| O-ureido-D-serine (CHEBI:74212) is a ureas (CHEBI:47857) |
| O-ureido-D-serine (CHEBI:74212) is tautomer of O-ureido-D-serine zwitterion (CHEBI:74158) |
| Incoming Relation(s) |
| O-ureido-D-serine zwitterion (CHEBI:74158) is tautomer of O-ureido-D-serine (CHEBI:74212) |
| IUPAC Name |
|---|
| O-(carbamoylamino)-D-serine |
| Synonym | Source |
|---|---|
| (2R)-2-Amino-3-(carbamoylamino)oxypropanoic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CPD-15320 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6696521 | Reaxys |
| CAS:53459-31-7 | ChemIDplus |
| Citations |
|---|