EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26N2O15P2 |
| Net Charge | 0 |
| Average Mass | 548.331 |
| Monoisotopic Mass | 548.08084 |
| SMILES | [H][C@@]1([C@@H](C)O)O[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](n3cc(C)c(=O)nc3=O)C[C@@H]2O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H26N2O15P2/c1-6-4-18(16(24)17-14(6)23)10-3-8(20)9(30-10)5-29-34(25,26)33-35(27,28)32-15-12(22)11(21)13(31-15)7(2)19/h4,7-13,15,19-22H,3,5H2,1-2H3,(H,25,26)(H,27,28)(H,17,23,24)/t7-,8+,9-,10-,11-,12-,13+,15+/m1/s1 |
| InChIKey | NPFKVELMLMVECN-HDWGPDLJSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dTDP-β-D-fucofuranose (CHEBI:74186) has role metabolite (CHEBI:25212) |
| dTDP-β-D-fucofuranose (CHEBI:74186) is a dTDP-sugar (CHEBI:23557) |
| dTDP-β-D-fucofuranose (CHEBI:74186) is conjugate acid of dTDP-β-D-fucofuranose(2−) (CHEBI:74157) |
| Incoming Relation(s) |
| dTDP-β-D-fucofuranose(2−) (CHEBI:74157) is conjugate base of dTDP-β-D-fucofuranose (CHEBI:74186) |
| IUPAC Names |
|---|
| thymidine 5'-[3-(6-deoxy-β-D-galactofuranosyl) dihydrogen diphosphate] |
| thymidine 5'-[3-(β-D-fucofuranosyl) dihydrogen diphosphate] |
| Synonym | Source |
|---|---|
| dTDP-β-D-Fucf | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-15407 | MetaCyc |
| US2012041185 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22257338 | Reaxys |
| Citations |
|---|