EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO4S |
| Net Charge | 0 |
| Average Mass | 193.224 |
| Monoisotopic Mass | 193.04088 |
| SMILES | CSC(CC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C6H11NO4S/c1-12-4(6(10)11)2-3(7)5(8)9/h3-4H,2,7H2,1H3,(H,8,9)(H,10,11) |
| InChIKey | LBNSWLUTRJJRJP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-thiomethyl glutamate (CHEBI:74129) has role metabolite (CHEBI:25212) |
| γ-thiomethyl glutamate (CHEBI:74129) is a glutamic acid derivative (CHEBI:24315) |
| γ-thiomethyl glutamate (CHEBI:74129) is a methyl sulfide (CHEBI:86315) |
| γ-thiomethyl glutamate (CHEBI:74129) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| γ-thiomethyl glutamate (CHEBI:74129) is a sulfur-containing amino acid (CHEBI:26834) |
| Manual Xrefs | Databases |
|---|---|
| CPD0-2023 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4984281 | Reaxys |