EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H15N3O2 |
| Net Charge | 0 |
| Average Mass | 173.216 |
| Monoisotopic Mass | 173.11643 |
| SMILES | N=C(N)NCCCCCC(=O)O |
| InChI | InChI=1S/C7H15N3O2/c8-7(9)10-5-3-1-2-4-6(11)12/h1-5H2,(H,11,12)(H4,8,9,10) |
| InChIKey | NSDYIDKTTPXCRH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-guanidinohexanoic acid (CHEBI:74123) has role metabolite (CHEBI:25212) |
| 6-guanidinohexanoic acid (CHEBI:74123) is a guanidines (CHEBI:24436) |
| IUPAC Name |
|---|
| 6-carbamimidamidohexanoic acid |
| Synonyms | Source |
|---|---|
| 6-guanidinocaproic acid | ChEBI |
| ε-guanidinocaproic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1774244 | Reaxys |
| CAS:6659-35-4 | ChemIDplus |