EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO3S2 |
| Net Charge | 0 |
| Average Mass | 197.281 |
| Monoisotopic Mass | 197.01804 |
| SMILES | N[C@@H](CSSCCO)C(=O)O |
| InChI | InChI=1S/C5H11NO3S2/c6-4(5(8)9)3-11-10-2-1-7/h4,7H,1-3,6H2,(H,8,9)/t4-/m0/s1 |
| InChIKey | YPUBRSXDQSFQBA-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-[(2-hydroxyethyl)disulfanyl]-L-alanine (CHEBI:74104) has role metabolite (CHEBI:25212) |
| 3-[(2-hydroxyethyl)disulfanyl]-L-alanine (CHEBI:74104) is a S-substituted L-cysteine (CHEBI:47910) |
| IUPAC Name |
|---|
| 3-[(2-hydroxyethyl)disulfanyl]-L-alanine |
| Synonyms | Source |
|---|---|
| cysteinemercaptoethanol disulfide | ChEBI |
| S-(2-Hydroxyethylmercapto)-L-cysteine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1707531 | Reaxys |
| CAS:38254-63-6 | ChemIDplus |