EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22N5O7P |
| Net Charge | 0 |
| Average Mass | 415.343 |
| Monoisotopic Mass | 415.12568 |
| SMILES | CC(C)=CCNc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H22N5O7P/c1-8(2)3-4-16-13-10-14(18-6-17-13)20(7-19-10)15-12(22)11(21)9(27-15)5-26-28(23,24)25/h3,6-7,9,11-12,15,21-22H,4-5H2,1-2H3,(H,16,17,18)(H2,23,24,25)/t9-,11-,12-,15-/m1/s1 |
| InChIKey | DUISZFLWBAPRBR-SDBHATRESA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-(dimethylallyl)adenosine 5'-monophosphate (CHEBI:15819) is a N6-dimethylallyladenosine 5'-monophosphate (CHEBI:21865) |
| N6-(dimethylallyl)adenosine 5'-monophosphate (CHEBI:15819) is conjugate acid of N6-(dimethylallyl)adenosine 5'-phosphate(2−) (CHEBI:57526) |
| Incoming Relation(s) |
| N6-(dimethylallyl)adenosine 5'-phosphate(2−) (CHEBI:57526) is conjugate base of N6-(dimethylallyl)adenosine 5'-monophosphate (CHEBI:15819) |
| N6-dimethylallyladenine 5'-monophosphate residue (CHEBI:74638) is substituent group from N6-(dimethylallyl)adenosine 5'-monophosphate (CHEBI:15819) |
| IUPAC Name |
|---|
| N6-(3-methylbut-2-en-1-yl)adenosine 5'-(dihydrogen phosphate) |
| Synonyms | Source |
|---|---|
| N6-dimethylallyl-5'-adenylic acid | ChEBI |
| N6-(dimethylallyl)adenosine 5'-(dihydrogen phosphate) | ChEBI |
| N6-(dimethylallyl)adenosine 5'-phosphate | MetaCyc |
| N6-dimethylallyl-AMP | ChEBI |
| N6-isopentenyladenosine-5'-monophosphate | ChEBI |
| N6-(Δ2-isopentenyl)adenosine 5'-monophosphate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1054610 | Reaxys |
| CAS:20268-93-3 | ChemIDplus |
| Citations |
|---|