EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8N2S |
| Net Charge | 0 |
| Average Mass | 116.189 |
| Monoisotopic Mass | 116.04082 |
| SMILES | C=CCNC(N)=S |
| InChI | InChI=1S/C4H8N2S/c1-2-3-6-4(5)7/h2H,1,3H2,(H3,5,6,7) |
| InChIKey | HTKFORQRBXIQHD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| allylthiourea (CHEBI:74079) has functional parent thiourea (CHEBI:36946) |
| allylthiourea (CHEBI:74079) has role metabolite (CHEBI:25212) |
| allylthiourea (CHEBI:74079) is a thioureas (CHEBI:51276) |
| IUPAC Name |
|---|
| 1-prop-2-en-1-ylthiourea |
| Synonyms | Source |
|---|---|
| 1-Allyl-2-thiourea | ChemIDplus |
| (2-Propenyl)thiourea | ChemIDplus |
| Tiosinamine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1071470 | Reaxys |
| CAS:109-57-9 | ChemIDplus |
| Citations |
|---|