EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19N5O3 |
| Net Charge | 0 |
| Average Mass | 341.371 |
| Monoisotopic Mass | 341.14879 |
| SMILES | N[C@@H](Cc1cncn1)C(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C17H19N5O3/c18-13(6-11-8-19-9-21-11)16(23)22-15(17(24)25)5-10-7-20-14-4-2-1-3-12(10)14/h1-4,7-9,13,15,20H,5-6,18H2,(H,19,21)(H,22,23)(H,24,25)/t13-,15-/m0/s1 |
| InChIKey | FBTYOQIYBULKEH-ZFWWWQNUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| His-Trp (CHEBI:74058) has role metabolite (CHEBI:25212) |
| His-Trp (CHEBI:74058) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-histidyl-L-tryptophan |
| Synonyms | Source |
|---|---|
| Histidinyl-Tryptophan | HMDB |
| histidyltryptophan | ChEBI |
| HW | ChEBI |
| L-His-L-Trp | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028896 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4275044 | Reaxys |