EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14N4O4 |
| Net Charge | 0 |
| Average Mass | 242.235 |
| Monoisotopic Mass | 242.10150 |
| SMILES | N[C@@H](Cc1cncn1)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C9H14N4O4/c10-6(1-5-2-11-4-12-5)8(15)13-7(3-14)9(16)17/h2,4,6-7,14H,1,3,10H2,(H,11,12)(H,13,15)(H,16,17)/t6-,7-/m0/s1 |
| InChIKey | KRBMQYPTDYSENE-BQBZGAKWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| His-Ser (CHEBI:74056) has role metabolite (CHEBI:25212) |
| His-Ser (CHEBI:74056) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-histidyl-L-serine |
| Synonyms | Source |
|---|---|
| HS | ChEBI |
| L-His-L-Ser | ChEBI |
| histidylserine | ChEBI |
| Histidinyl-Serine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028894 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:756048 | Reaxys |