EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16N4O3 |
| Net Charge | 0 |
| Average Mass | 252.274 |
| Monoisotopic Mass | 252.12224 |
| SMILES | N[C@@H](Cc1cncn1)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C11H16N4O3/c12-8(4-7-5-13-6-14-7)10(16)15-3-1-2-9(15)11(17)18/h5-6,8-9H,1-4,12H2,(H,13,14)(H,17,18)/t8-,9-/m0/s1 |
| InChIKey | LNCFUHAPNTYMJB-IUCAKERBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| His-Pro (CHEBI:74055) has role metabolite (CHEBI:25212) |
| His-Pro (CHEBI:74055) is a dipeptide (CHEBI:46761) |
| His-Pro (CHEBI:74055) is tautomer of His-Pro zwitterion (CHEBI:147379) |
| Incoming Relation(s) |
| His-Pro zwitterion (CHEBI:147379) is tautomer of His-Pro (CHEBI:74055) |
| IUPAC Name |
|---|
| L-histidyl-L-proline |
| Synonyms | Source |
|---|---|
| L-His-L-Pro | ChEBI |
| HP | ChEBI |
| histidylproline | ChEBI |
| Histidinyl-Proline | HMDB |
| H-P | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028893 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:679118 | Reaxys |
| CAS:20930-58-9 | ChemIDplus |