EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H21N5O3 |
| Net Charge | 0 |
| Average Mass | 283.332 |
| Monoisotopic Mass | 283.16444 |
| SMILES | NCCCC[C@H](NC(=O)[C@@H](N)Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C12H21N5O3/c13-4-2-1-3-10(12(19)20)17-11(18)9(14)5-8-6-15-7-16-8/h6-7,9-10H,1-5,13-14H2,(H,15,16)(H,17,18)(H,19,20)/t9-,10-/m0/s1 |
| InChIKey | CZVQSYNVUHAILZ-UWVGGRQHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| His-Lys (CHEBI:74052) has role metabolite (CHEBI:25212) |
| His-Lys (CHEBI:74052) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-histidyl-L-lysine |
| Synonyms | Source |
|---|---|
| histidyllysine | ChEBI |
| HK | ChEBI |
| L-His-L-Lys | ChEBI |
| N2-L-histidyl-L-lysine | ChemIDplus |
| Nα-L-histidyl-L-lysine | ChEBI |
| Histidinyl-Lysine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028890 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:692771 | Reaxys |
| CAS:37700-85-9 | ChemIDplus |