EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H17N5O3S |
| Net Charge | 0 |
| Average Mass | 311.367 |
| Monoisotopic Mass | 311.10521 |
| SMILES | CCSC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H17N5O3S/c1-2-21-3-6-8(18)9(19)12(20-6)17-5-16-7-10(13)14-4-15-11(7)17/h4-6,8-9,12,18-19H,2-3H2,1H3,(H2,13,14,15)/t6-,8-,9-,12-/m1/s1 |
| InChIKey | HMXHURAGFHWODC-WOUKDFQISA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5'-ethylthioadenosine (CHEBI:74046) has functional parent adenosine (CHEBI:16335) |
| 5'-ethylthioadenosine (CHEBI:74046) has role metabolite (CHEBI:25212) |
| 5'-ethylthioadenosine (CHEBI:74046) is a thioadenosine (CHEBI:26953) |
| IUPAC Name |
|---|
| 5'-S-ethyl-5'-thioadenosine |
| Synonym | Source |
|---|---|
| S-adenosylethane | PDBeChem |