EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N4O4 |
| Net Charge | 0 |
| Average Mass | 256.262 |
| Monoisotopic Mass | 256.11715 |
| SMILES | N[C@@H](CCc1ncc(C[C@H](N)C(=O)O)n1)C(=O)O |
| InChI | InChI=1S/C10H16N4O4/c11-6(9(15)16)1-2-8-13-4-5(14-8)3-7(12)10(17)18/h4,6-7H,1-3,11-12H2,(H,13,14)(H,15,16)(H,17,18)/t6-,7-/m0/s1 |
| InChIKey | CJCSNWWKPUXVRD-BQBZGAKWSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[(3S)-3-amino-3-carboxypropyl]-L-histidine (CHEBI:74043) is a 2-(3-amino-3-carboxypropyl)-L-histidine (CHEBI:17144) |
| 2-[(3S)-3-amino-3-carboxypropyl]-L-histidine (CHEBI:74043) is tautomer of 2-[(3S)-3-amino-3-carboxypropyl]-L-histidine dizwitterion (CHEBI:74042) |
| Incoming Relation(s) |
| 2-[(3S)-3-amino-3-carboxypropyl]-L-histidine dizwitterion (CHEBI:74042) is tautomer of 2-[(3S)-3-amino-3-carboxypropyl]-L-histidine (CHEBI:74043) |
| IUPAC Name |
|---|
| 2-[(3S)-3-amino-3-carboxypropyl]-L-histidine |