EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14O |
| Net Charge | 0 |
| Average Mass | 150.221 |
| Monoisotopic Mass | 150.10447 |
| SMILES | CC(C)=CCCc1ccoc1 |
| InChI | InChI=1S/C10H14O/c1-9(2)4-3-5-10-6-7-11-8-10/h4,6-8H,3,5H2,1-2H3 |
| InChIKey | XNGKCOFXDHYSGR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perillene (CHEBI:74039) has role fragrance (CHEBI:48318) |
| perillene (CHEBI:74039) has role metabolite (CHEBI:25212) |
| perillene (CHEBI:74039) has role semiochemical (CHEBI:26645) |
| perillene (CHEBI:74039) is a furans (CHEBI:24129) |
| perillene (CHEBI:74039) is a monoterpenoid (CHEBI:25409) |
| IUPAC Name |
|---|
| 3-(4-methylpent-3-en-1-yl)furan |
| Synonyms | Source |
|---|---|
| 3-(4-methyl-3-pentenyl)furan | ChemIDplus |
| perillen | NIST Chemistry WebBook |
| Citations |
|---|