EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14O |
| Net Charge | 0 |
| Average Mass | 150.221 |
| Monoisotopic Mass | 150.10447 |
| SMILES | CC(C)=CCCc1ccoc1 |
| InChI | InChI=1S/C10H14O/c1-9(2)4-3-5-10-6-7-11-8-10/h4,6-8H,3,5H2,1-2H3 |
| InChIKey | XNGKCOFXDHYSGR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| Application: | fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perillene (CHEBI:74039) has role fragrance (CHEBI:48318) |
| perillene (CHEBI:74039) has role metabolite (CHEBI:25212) |
| perillene (CHEBI:74039) has role semiochemical (CHEBI:26645) |
| perillene (CHEBI:74039) is a furans (CHEBI:24129) |
| perillene (CHEBI:74039) is a monoterpenoid (CHEBI:25409) |
| IUPAC Name |
|---|
| 3-(4-methylpent-3-en-1-yl)furan |
| Synonyms | Source |
|---|---|
| 3-(4-methyl-3-pentenyl)furan | ChemIDplus |
| perillen | NIST Chemistry WebBook |
| Citations |
|---|