EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9N3O |
| Net Charge | 0 |
| Average Mass | 139.158 |
| Monoisotopic Mass | 139.07456 |
| SMILES | CCn1c(N)ccnc1=O |
| InChI | InChI=1S/C6H9N3O/c1-2-9-5(7)3-4-8-6(9)10/h3-4H,2,7H2,1H3 |
| InChIKey | BOJJYWPYGHMXDH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-ethylcytosine (CHEBI:74029) has functional parent cytosine (CHEBI:16040) |
| 3-ethylcytosine (CHEBI:74029) has role metabolite (CHEBI:25212) |
| 3-ethylcytosine (CHEBI:74029) is a aminopyrimidine (CHEBI:38338) |
| 3-ethylcytosine (CHEBI:74029) is a pyrimidone (CHEBI:38337) |
| IUPAC Name |
|---|
| 6-amino-1-ethylpyrimidin-2(1H)-one |
| Manual Xrefs | Databases |
|---|---|
| CPD0-1929 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5503061 | Reaxys |