EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H4O3 |
| Net Charge | 0 |
| Average Mass | 100.073 |
| Monoisotopic Mass | 100.01604 |
| SMILES | C=CC(=O)C(=O)O |
| InChI | InChI=1S/C4H4O3/c1-2-3(5)4(6)7/h2H,1H2,(H,6,7) |
| InChIKey | DGUBLKUCHAAUFT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxobut-3-enoic acid (CHEBI:74021) has role metabolite (CHEBI:25212) |
| 2-oxobut-3-enoic acid (CHEBI:74021) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| 2-oxobut-3-enoic acid (CHEBI:74021) is a enone (CHEBI:51689) |
| IUPAC Name |
|---|
| 2-oxobut-3-enoic acid |
| Synonym | Source |
|---|---|
| Vinylglyoxylate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20002452 | Reaxys |
| CAS:56842-76-3 | ChemIDplus |