EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H19NO6 |
| Net Charge | 0 |
| Average Mass | 381.384 |
| Monoisotopic Mass | 381.12124 |
| SMILES | CC(C)=CCc1cc(C(=O)Nc2c(O)c3ccc(O)cc3oc2=O)ccc1O |
| InChI | InChI=1S/C21H19NO6/c1-11(2)3-4-12-9-13(5-8-16(12)24)20(26)22-18-19(25)15-7-6-14(23)10-17(15)28-21(18)27/h3,5-10,23-25H,4H2,1-2H3,(H,22,26) |
| InChIKey | HVPRXGNWCQFXRR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-desmethylnovobiocic acid (CHEBI:74005) has role metabolite (CHEBI:25212) |
| 8-desmethylnovobiocic acid (CHEBI:74005) is a benzamides (CHEBI:22702) |
| 8-desmethylnovobiocic acid (CHEBI:74005) is a hydroxycoumarin (CHEBI:37912) |
| 8-desmethylnovobiocic acid (CHEBI:74005) is a polyphenol (CHEBI:26195) |
| 8-desmethylnovobiocic acid (CHEBI:74005) is conjugate acid of 8-desmethylnovobiocic acid(1−) (CHEBI:73954) |
| Incoming Relation(s) |
| 8-desmethylnovobiocic acid(1−) (CHEBI:73954) is conjugate base of 8-desmethylnovobiocic acid (CHEBI:74005) |
| IUPAC Name |
|---|
| N-(4,7-dihydroxy-2-oxo-2H-chromen-3-yl)-4-hydroxy-3-(3-methylbut-2-en-1-yl)benzamide |
| Synonym | Source |
|---|---|
| 8-demethylnovobiocic acid | ChEBI |
| Citations |
|---|