EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H28O6 |
| Net Charge | 0 |
| Average Mass | 316.394 |
| Monoisotopic Mass | 316.18859 |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1OC(O)C[C@H](O)[C@@H]1CCC(=O)O |
| InChI | InChI=1S/C16H28O6/c1-2-3-4-5-11(17)6-8-14-12(7-9-15(19)20)13(18)10-16(21)22-14/h6,8,11-14,16-18,21H,2-5,7,9-10H2,1H3,(H,19,20)/b8-6+/t11-,12-,13-,14+,16?/m0/s1 |
| InChIKey | AXWSHCHWXXNNKN-GIGVETMCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3,4,5-tetranor-thromboxane B1 (CHEBI:74003) has functional parent thromboxane B1 (CHEBI:73994) |
| 2,3,4,5-tetranor-thromboxane B1 (CHEBI:74003) has role rat metabolite (CHEBI:86264) |
| 2,3,4,5-tetranor-thromboxane B1 (CHEBI:74003) is a monocarboxylic acid (CHEBI:25384) |
| 2,3,4,5-tetranor-thromboxane B1 (CHEBI:74003) is a secondary allylic alcohol (CHEBI:134396) |
| 2,3,4,5-tetranor-thromboxane B1 (CHEBI:74003) is a thromboxanes B (CHEBI:26996) |
| IUPAC Name |
|---|
| (5R)-4-(2-carboxyethyl)-2,4-dideoxy-5-[(1E,3S)-3-hydroxyoct-1-en-1-yl]-D-erythro-pentopyranose |
| Synonyms | Source |
|---|---|
| 2,3,4,5-tetranorthromboxane B1 | ChEBI |
| 2,3,4,5-tetranor-TXB1 | ChEBI |
| tetranor-TXB1 | ChEBI |
| Citations |
|---|