EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26O7 |
| Net Charge | 0 |
| Average Mass | 330.377 |
| Monoisotopic Mass | 330.16785 |
| SMILES | O=C(O)CCCCC(=O)CC[C@@H]1[C@@H](CCC(=O)O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C16H26O7/c17-10(3-1-2-4-15(20)21)5-6-11-12(7-8-16(22)23)14(19)9-13(11)18/h11-14,18-19H,1-9H2,(H,20,21)(H,22,23)/t11-,12-,13-,14+/m1/s1 |
| InChIKey | IGRHJCFWWOQYQE-SYQHCUMBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3,4,5-tetranor-prostaglandin FM (CHEBI:73989) has role metabolite (CHEBI:25212) |
| 2,3,4,5-tetranor-prostaglandin FM (CHEBI:73989) is a ketone (CHEBI:17087) |
| 2,3,4,5-tetranor-prostaglandin FM (CHEBI:73989) is a oxo dicarboxylic acid (CHEBI:36145) |
| 2,3,4,5-tetranor-prostaglandin FM (CHEBI:73989) is a prostanoid (CHEBI:26347) |
| 2,3,4,5-tetranor-prostaglandin FM (CHEBI:73989) is a secondary alcohol (CHEBI:35681) |
| IUPAC Names |
|---|
| 8-[(1R,2R,3S,5R)-2-(2-carboxyethyl)-3,5-dihydroxycyclopentyl]-6-oxooctanoic acid |
| 9α,11α,dihydroxy-2,3,4,5-tetranor-15-oxo-prostan-1,20-dioic acid |
| Synonyms | Source |
|---|---|
| 2,3,4,5-tetranor-PGFM | ChEBI |
| 2,3,4,5-tetranor-prostaglandin F metabolite | ChEBI |
| (9S,11R)-dihydroxy-15-oxo-2,3,4,5-tetranor-prostan-1,20-dioic acid | ChEBI |
| 9S,11R-dihydroxy-15-oxo-2,3,4,5-tetranor-prostan-1,20-dioic acid | LIPID MAPS |
| tetranor-PGFM | LIPID MAPS |
| tetranor-prostaglandin FM | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA03010139 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2999249 | Reaxys |