EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26O5 |
| Net Charge | 0 |
| Average Mass | 298.379 |
| Monoisotopic Mass | 298.17802 |
| SMILES | CCCCCC(=O)/C=C/[C@@H]1[C@@H](CCC(=O)O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C16H26O5/c1-2-3-4-5-11(17)6-7-12-13(8-9-16(20)21)15(19)10-14(12)18/h6-7,12-15,18-19H,2-5,8-10H2,1H3,(H,20,21)/b7-6+/t12-,13-,14-,15+/m1/s1 |
| InChIKey | BZVKQDSLFYXLAI-BNBDNKSYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3,4,5-tetranor-15-oxoprostaglandin F2α (CHEBI:73983) has role metabolite (CHEBI:25212) |
| 2,3,4,5-tetranor-15-oxoprostaglandin F2α (CHEBI:73983) is a enone (CHEBI:51689) |
| 2,3,4,5-tetranor-15-oxoprostaglandin F2α (CHEBI:73983) is a oxo monocarboxylic acid (CHEBI:35871) |
| 2,3,4,5-tetranor-15-oxoprostaglandin F2α (CHEBI:73983) is a prostanoid (CHEBI:26347) |
| 2,3,4,5-tetranor-15-oxoprostaglandin F2α (CHEBI:73983) is a secondary alcohol (CHEBI:35681) |
| IUPAC Names |
|---|
| (13E)-9α,11α-dihydroxy-2,3,4,5-tetranor-15-oxoprosta-13-en-1-oic acid |
| 3-{(1R,2R,3R,5S)-3,5-dihydroxy-2-[(1E)-3-oxooct-1-en-1-yl]cyclopentyl}propanoic acid |
| Synonyms | Source |
|---|---|
| 15-keto-2,3,4,5-tetranor-PGF2α | ChEBI |
| 15-keto-2,3,4,5-tetranorprostaglandin F2α | ChEBI |
| 2,3,4,5-tetranor-15-keto-PGF2α | ChEBI |
| 2,3,4,5-tetranor-15-oxo-PGF2α | ChEBI |
| 2,3,4,5-tetranor-15-oxo-prostaglandin F2α | ChEBI |