EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H22O4 |
| Net Charge | 0 |
| Average Mass | 242.315 |
| Monoisotopic Mass | 242.15181 |
| SMILES | [H][C@@]1(CO)COC(=O)[C@@]1([H])C(=O)CCCCC(C)C |
| InChI | InChI=1S/C13H22O4/c1-9(2)5-3-4-6-11(15)12-10(7-14)8-17-13(12)16/h9-10,12,14H,3-8H2,1-2H3/t10-,12-/m1/s1 |
| InChIKey | REAWNMHCBIUKLZ-ZYHUDNBSSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R,4R)-4-(hydroxymethyl)-3-(6-methylheptanoyl)oxolan-2-one (CHEBI:73982) has functional parent γ-butyrolactone (CHEBI:42639) |
| (3R,4R)-4-(hydroxymethyl)-3-(6-methylheptanoyl)oxolan-2-one (CHEBI:73982) has role metabolite (CHEBI:25212) |
| (3R,4R)-4-(hydroxymethyl)-3-(6-methylheptanoyl)oxolan-2-one (CHEBI:73982) is a butan-4-olide (CHEBI:22950) |
| (3R,4R)-4-(hydroxymethyl)-3-(6-methylheptanoyl)oxolan-2-one (CHEBI:73982) is a primary alcohol (CHEBI:15734) |
| IUPAC Name |
|---|
| (3R,4R)-4-(hydroxymethyl)-3-(6-methylheptanoyl)dihydrofuran-2(3H)-one |
| Synonyms | Source |
|---|---|
| 3β-(6-methylheptanoyl)-4α-(hydroxymethyl)-4,5-dihydrofuran-2(3H)-one | ChEBI |
| A-Factor | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-10135 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4747237 | Reaxys |
| CAS:51311-41-2 | ChemIDplus |
| Citations |
|---|