EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N5O2 |
| Net Charge | 0 |
| Average Mass | 223.236 |
| Monoisotopic Mass | 223.10692 |
| SMILES | CC1(C)Nc2nc(N)nc(=O)c2N=C1CO |
| InChI | InChI=1S/C9H13N5O2/c1-9(2)4(3-15)11-5-6(14-9)12-8(10)13-7(5)16/h15H,3H2,1-2H3,(H4,10,12,13,14,16) |
| InChIKey | JWNVZJZMJXISNG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-6-hydroxymethyl-7,7-dimethyl-7,8-dihydropteridin-4-one (CHEBI:73981) has functional parent 2-amino-6-(hydroxymethyl)-7,8-dihydropteridin-4-one (CHEBI:44841) |
| 2-amino-6-hydroxymethyl-7,7-dimethyl-7,8-dihydropteridin-4-one (CHEBI:73981) has role metabolite (CHEBI:25212) |
| 2-amino-6-hydroxymethyl-7,7-dimethyl-7,8-dihydropteridin-4-one (CHEBI:73981) is a dihydropterin (CHEBI:38797) |
| IUPAC Name |
|---|
| 2-amino-6-(hydroxymethyl)-7,7-dimethyl-7,8-dihydropteridin-4(1H)-one |
| Manual Xrefs | Databases |
|---|---|
| CPD0-1716 | MetaCyc |