EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12N4O3 |
| Net Charge | 0 |
| Average Mass | 188.187 |
| Monoisotopic Mass | 188.09094 |
| SMILES | [H][C@@]1([C@H](O)[C@H](N)C(=O)O)CNC(=N)N1 |
| InChI | InChI=1S/C6H12N4O3/c7-3(5(12)13)4(11)2-1-9-6(8)10-2/h2-4,11H,1,7H2,(H,12,13)(H3,8,9,10)/t2-,3-,4-/m0/s1 |
| InChIKey | RFBWLSHSKDHIQO-HZLVTQRSSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S)-3-hydroxy-L-enduracididine (CHEBI:73971) is a L-arginine derivative (CHEBI:83965) |
| (3S)-3-hydroxy-L-enduracididine (CHEBI:73971) is a L-histidine derivative (CHEBI:84076) |
| (3S)-3-hydroxy-L-enduracididine (CHEBI:73971) is a imidazolidines (CHEBI:38261) |
| (3S)-3-hydroxy-L-enduracididine (CHEBI:73971) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| (3S)-3-hydroxy-L-enduracididine (CHEBI:73971) is conjugate base of (3S)-3-hydroxy-L-enduracididine(1+) (CHEBI:73937) |
| Incoming Relation(s) |
| (3S)-3-hydroxy-L-enduracididine(1+) (CHEBI:73937) is conjugate acid of (3S)-3-hydroxy-L-enduracididine (CHEBI:73971) |
| IUPAC Name |
|---|
| (3R)-3-[(4S)-2-iminoimidazolidin-4-yl]-L-serine |
| Citations |
|---|