EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12N4O2 |
| Net Charge | 0 |
| Average Mass | 172.188 |
| Monoisotopic Mass | 172.09603 |
| SMILES | [H][C@@]1(C[C@H](N)C(=O)O)CNC(=N)N1 |
| InChI | InChI=1S/C6H12N4O2/c7-4(5(11)12)1-3-2-9-6(8)10-3/h3-4H,1-2,7H2,(H,11,12)(H3,8,9,10)/t3-,4+/m1/s1 |
| InChIKey | VFXRPXBQCNHQRQ-DMTCNVIQSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-enduracididine (CHEBI:73969) is a L-histidine derivative (CHEBI:84076) |
| L-enduracididine (CHEBI:73969) is a imidazolidines (CHEBI:38261) |
| L-enduracididine (CHEBI:73969) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-enduracididine (CHEBI:73969) is conjugate base of L-enduracididine(1+) (CHEBI:73936) |
| Incoming Relation(s) |
| L-enduracididine(1+) (CHEBI:73936) is conjugate acid of L-enduracididine (CHEBI:73969) |
| IUPAC Name |
|---|
| 3-[(4R)-2-iminoimidazolidin-4-yl]-L-alanine |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7704757 | Reaxys |
| Citations |
|---|