EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11O11P |
| Net Charge | 0 |
| Average Mass | 290.117 |
| Monoisotopic Mass | 290.00390 |
| SMILES | O=C(O)C(O)C(O)C(OP(=O)(O)O)C(O)C(=O)O |
| InChI | InChI=1S/C6H11O11P/c7-1(2(8)5(10)11)4(3(9)6(12)13)17-18(14,15)16/h1-4,7-9H,(H,10,11)(H,12,13)(H2,14,15,16) |
| InChIKey | FJYQVOPLAANXAB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3,5-trihydroxy-4-phosphonooxyadipic acid (CHEBI:73968) has functional parent adipic acid (CHEBI:30832) |
| 2,3,5-trihydroxy-4-phosphonooxyadipic acid (CHEBI:73968) has role metabolite (CHEBI:25212) |
| 2,3,5-trihydroxy-4-phosphonooxyadipic acid (CHEBI:73968) is a phosphate monoester (CHEBI:7794) |
| 2,3,5-trihydroxy-4-phosphonooxyadipic acid (CHEBI:73968) is a triol (CHEBI:27136) |
| 2,3,5-trihydroxy-4-phosphonooxyadipic acid (CHEBI:73968) is a α,ω-dicarboxylic acid (CHEBI:28383) |
| IUPAC Name |
|---|
| 3-O-phosphonohexaric acid |
| Synonym | Source |
|---|---|
| 2,3,5-trihydroxy-4-phosphonooxyhexanedioic acid | ChEBI |