EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24O7 |
| Net Charge | 0 |
| Average Mass | 328.361 |
| Monoisotopic Mass | 328.15220 |
| SMILES | O=C(O)CCCCC(=O)CC[C@H]1[C@H](O)CC(=O)[C@@H]1CCC(=O)O |
| InChI | InChI=1S/C16H24O7/c17-10(3-1-2-4-15(20)21)5-6-11-12(7-8-16(22)23)14(19)9-13(11)18/h11-13,18H,1-9H2,(H,20,21)(H,22,23)/t11-,12-,13-/m1/s1 |
| InChIKey | ZJAZCYLYLVCSNH-JHJVBQTASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin E2-UM (CHEBI:73965) has role metabolite (CHEBI:25212) |
| prostaglandin E2-UM (CHEBI:73965) is a cyclic ketone (CHEBI:3992) |
| prostaglandin E2-UM (CHEBI:73965) is a diketone (CHEBI:46640) |
| prostaglandin E2-UM (CHEBI:73965) is a oxo dicarboxylic acid (CHEBI:36145) |
| prostaglandin E2-UM (CHEBI:73965) is a prostanoid (CHEBI:26347) |
| prostaglandin E2-UM (CHEBI:73965) is a secondary alcohol (CHEBI:35681) |
| IUPAC Names |
|---|
| 11α-hydroxy-2,3,4,5-tetranor-9,15-dioxoprostan-1,20-dioic acid |
| 8-[(1R,2R,5R)-2-(2-carboxyethyl)-5-hydroxy-3-oxocyclopentyl]-6-oxooctanoic acid |
| Synonyms | Source |
|---|---|
| 11α-hydroxy-9,15-dioxo-2,3,4,5,20-pentanor-19-carboxyprostanoic acid | ChemIDplus |
| Hdopnp | ChemIDplus |
| PGE2-UM | ChEBI |
| PGE2UM | ChEBI |
| PGE-M | ChEBI |
| PGEM | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA03010032 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3004215 | Reaxys |
| CAS:24769-56-0 | ChemIDplus |
| Citations |
|---|