EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O3S |
| Net Charge | 0 |
| Average Mass | 272.325 |
| Monoisotopic Mass | 272.05072 |
| SMILES | O=C(/C=C/S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H12O3S/c16-15(13-7-3-1-4-8-13)11-12-19(17,18)14-9-5-2-6-10-14/h1-12H/b12-11+ |
| InChIKey | KPWYLVJFIPLFCW-VAWYXSNFSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-phenyl-3-(phenylsulfonyl)-2-propen-1-one (CHEBI:73960) has role metabolite (CHEBI:25212) |
| 1-phenyl-3-(phenylsulfonyl)-2-propen-1-one (CHEBI:73960) is a aromatic ketone (CHEBI:76224) |
| 1-phenyl-3-(phenylsulfonyl)-2-propen-1-one (CHEBI:73960) is a enone (CHEBI:51689) |
| 1-phenyl-3-(phenylsulfonyl)-2-propen-1-one (CHEBI:73960) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| (2E)-1-phenyl-3-(phenylsulfonyl)prop-2-en-1-one |
| Synonym | Source |
|---|---|
| 3-(Phenylsulfonyl)acrylophenone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C15077 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2214675 | Reaxys |