EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6N4O |
| Net Charge | 0 |
| Average Mass | 150.141 |
| Monoisotopic Mass | 150.05416 |
| SMILES | Cn1cnc2ncnc2c1=O |
| InChI | InChI=1S/C6H6N4O/c1-10-3-9-5-4(6(10)11)7-2-8-5/h2-3H,1H3,(H,7,8) |
| InChIKey | KIQMCGMHGVXDFW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (28238935) | Identified in the urine of pregnant women diagnosed with gestational diabetes mellitus. |
| Rattus norvegicus (ncbitaxon:10116) | urine (BTO:0001419) | PubMed (7397688) | Identified in the urine of Sprague-Dawley rats bearing Yoshida tumour. |
| Roles Classification |
|---|
| Biological Roles: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-methylhypoxanthine (CHEBI:73959) has role human urinary metabolite (CHEBI:84087) |
| 1-methylhypoxanthine (CHEBI:73959) has role rat metabolite (CHEBI:86264) |
| 1-methylhypoxanthine (CHEBI:73959) is a methylhypoxanthine (CHEBI:73958) |
| IUPAC Name |
|---|
| 1-methyl-1,7-dihydro-6H-purin-6-one |
| Synonyms | Source |
|---|---|
| 1,7-Dihydro-1-methyl-6H-Purin-6-one | HMDB |
| 1-Methyl-1,9-dihydro-6H-purin-6-one | HMDB |
| 1-methyl-hypoxanthine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013141 | HMDB |
| FDB029310 | FooDB |
| Citations |
|---|