EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H28O5 |
| Net Charge | 0 |
| Average Mass | 324.417 |
| Monoisotopic Mass | 324.19367 |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1C/C=C\CC(=O)O |
| InChI | InChI=1S/C18H28O5/c1-2-3-4-7-13(19)10-11-15-14(16(20)12-17(15)21)8-5-6-9-18(22)23/h5-6,10-11,13-15,17,19,21H,2-4,7-9,12H2,1H3,(H,22,23)/b6-5-,11-10+/t13-,14+,15+,17+/m0/s1 |
| InChIKey | KEULKCWSUHLQGJ-ZRXREZFBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-dinor-prostaglandin E2 (CHEBI:73952) has role metabolite (CHEBI:25212) |
| 2,3-dinor-prostaglandin E2 (CHEBI:73952) is a cyclic ketone (CHEBI:3992) |
| 2,3-dinor-prostaglandin E2 (CHEBI:73952) is a monocarboxylic acid (CHEBI:25384) |
| 2,3-dinor-prostaglandin E2 (CHEBI:73952) is a prostanoid (CHEBI:26347) |
| 2,3-dinor-prostaglandin E2 (CHEBI:73952) is a secondary alcohol (CHEBI:35681) |
| IUPAC Names |
|---|
| (3Z)-5-{(1R,2R,3R)-3-hydroxy-2-[(1E,3S)-3-hydroxyoct-1-en-1-yl]-5-oxocyclopentyl}pent-3-enoic acid |
| (5Z,13E,15S)-11α,15-dihydroxy-2,3-dinor-9-oxoprosta-5,13-dien-1-oic acid |
| Synonyms | Source |
|---|---|
| dinor-PGE2 | LIPID MAPS |
| 2,3-dinor-PGE2 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA03010210 | LIPID MAPS |