EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H15N4O3 |
| Net Charge | +1 |
| Average Mass | 191.211 |
| Monoisotopic Mass | 191.11387 |
| SMILES | NC(=[NH2+])NCC[C@H](O)[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C6H14N4O3/c7-4(5(12)13)3(11)1-2-10-6(8)9/h3-4,11H,1-2,7H2,(H,12,13)(H4,8,9,10)/p+1/t3-,4-/m0/s1 |
| InChIKey | VIDUVSPOWYVZIC-IMJSIDKUSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S)-3-hydroxy-L-arginine(1+) (CHEBI:73938) is a α-amino-acid cation (CHEBI:33719) |
| (3S)-3-hydroxy-L-arginine(1+) (CHEBI:73938) is conjugate acid of (3S)-3-hydroxy-L-arginine (CHEBI:73972) |
| Incoming Relation(s) |
| (3S)-3-hydroxy-L-arginine (CHEBI:73972) is conjugate base of (3S)-3-hydroxy-L-arginine(1+) (CHEBI:73938) |
| IUPAC Name |
|---|
| 5-{[amino(iminio)methyl]amino}-2-azaniumyl-2,4,5-trideoxy-L-erythro-pentonate |
| Synonym | Source |
|---|---|
| (3S)-3-hydroxy-L-argininium | ChEBI |
| UniProt Name | Source |
|---|---|
| (2S,3S)-hydroxyarginine | UniProt |
| Citations |
|---|