EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H2ClO2 |
| Net Charge | -1 |
| Average Mass | 105.500 |
| Monoisotopic Mass | 104.97488 |
| SMILES | C=C(Cl)C(=O)[O-] |
| InChI | InChI=1S/C3H3ClO2/c1-2(4)3(5)6/h1H2,(H,5,6)/p-1 |
| InChIKey | SZTBMYHIYNGYIA-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | nitric oxide synthase activator Any compound that binds to and activates the enzyme nitric oxide synthase (EC 1.14.13.39). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-chloroacrylate (CHEBI:73935) has role nitric oxide synthase activator (CHEBI:73966) |
| 2-chloroacrylate (CHEBI:73935) is a monocarboxylic acid anion (CHEBI:35757) |
| 2-chloroacrylate (CHEBI:73935) is conjugate base of 2-chloroacrylic acid (CHEBI:73963) |
| Incoming Relation(s) |
| 2-chloroacrylic acid (CHEBI:73963) is conjugate acid of 2-chloroacrylate (CHEBI:73935) |
| IUPAC Name |
|---|
| 2-chloroprop-2-enoate |
| Synonym | Source |
|---|---|
| α-chloroacrylate | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-chloroacrylate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3661137 | Reaxys |
| Citations |
|---|