EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12N4O3 |
| Net Charge | 0 |
| Average Mass | 212.209 |
| Monoisotopic Mass | 212.09094 |
| SMILES | N[C@@H](Cc1cncn1)C(=O)NCC(=O)O |
| InChI | InChI=1S/C8H12N4O3/c9-6(1-5-2-10-4-12-5)8(15)11-3-7(13)14/h2,4,6H,1,3,9H2,(H,10,12)(H,11,15)(H,13,14)/t6-/m0/s1 |
| InChIKey | LYCVKHSJGDMDLM-LURJTMIESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| His-Gly (CHEBI:73930) has role metabolite (CHEBI:25212) |
| His-Gly (CHEBI:73930) is a dipeptide (CHEBI:46761) |
| His-Gly (CHEBI:73930) is tautomer of His-Gly zwitterion (CHEBI:229957) |
| Incoming Relation(s) |
| His-Gly zwitterion (CHEBI:229957) is tautomer of His-Gly (CHEBI:73930) |
| IUPAC Name |
|---|
| L-histidylglycine |
| Synonyms | Source |
|---|---|
| H-G | ChEBI |
| HG | ChEBI |
| H-G dipeptide | HMDB |
| HG dipeptide | HMDB |
| Histidinyl-Glycine | HMDB |
| histidylglycine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| FDB111914 | FooDB |
| HMDB0028885 | HMDB |
| Citations |
|---|