EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16N4O5 |
| Net Charge | 0 |
| Average Mass | 284.272 |
| Monoisotopic Mass | 284.11207 |
| SMILES | N[C@@H](Cc1cncn1)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H16N4O5/c12-7(3-6-4-13-5-14-6)10(18)15-8(11(19)20)1-2-9(16)17/h4-5,7-8H,1-3,12H2,(H,13,14)(H,15,18)(H,16,17)(H,19,20)/t7-,8-/m0/s1 |
| InChIKey | VHOLZZKNEBBHTH-YUMQZZPRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| His-Glu (CHEBI:73928) has role metabolite (CHEBI:25212) |
| His-Glu (CHEBI:73928) is a dipeptide (CHEBI:46761) |
| Synonyms | Source |
|---|---|
| HE | ChEBI |
| Histidinyl-Glutamate | HMDB |
| histidylglutamate | ChEBI |
| histidylglutamic acid | ChEBI |
| L-His-L-Glu | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028884 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:932116 | Reaxys |