EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O5 |
| Net Charge | 0 |
| Average Mass | 490.725 |
| Monoisotopic Mass | 490.36582 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCCC(C)(C)O)[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O)[C@@H](OCCCO)[C@H](O)C1=C |
| InChI | InChI=1S/C30H50O5/c1-20(9-6-15-29(3,4)34)24-13-14-25-22(10-7-16-30(24,25)5)11-12-23-19-26(32)28(27(33)21(23)2)35-18-8-17-31/h11-12,20,24-28,31-34H,2,6-10,13-19H2,1,3-5H3/b22-11+,23-12-/t20-,24-,25+,26-,27-,28-,30-/m1/s1 |
| InChIKey | FZEXGDDBXLBRTD-AYIMTCTASA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1α,25-dihydroxy-2β-(3-hydroxypropoxy)vitamin D3 (CHEBI:73927) has functional parent calcitriol (CHEBI:17823) |
| 1α,25-dihydroxy-2β-(3-hydroxypropoxy)vitamin D3 (CHEBI:73927) has role metabolite (CHEBI:25212) |
| 1α,25-dihydroxy-2β-(3-hydroxypropoxy)vitamin D3 (CHEBI:73927) is a D3 vitamins (CHEBI:73558) |
| 1α,25-dihydroxy-2β-(3-hydroxypropoxy)vitamin D3 (CHEBI:73927) is a hydroxycalciol (CHEBI:47042) |
| 1α,25-dihydroxy-2β-(3-hydroxypropoxy)vitamin D3 (CHEBI:73927) is a tetrol (CHEBI:33573) |
| Incoming Relation(s) |
| 1α,25-dihydroxy-2β-(1,3-dihydroxypropoxy)vitamin D3 (CHEBI:146141) has functional parent 1α,25-dihydroxy-2β-(3-hydroxypropoxy)vitamin D3 (CHEBI:73927) |
| IUPAC Name |
|---|
| (1R,2R,3R,5Z,7E)-2-(3-hydroxypropoxy)-9,10-secocholesta-5,7,10-triene-1,3,25-triol |
| Synonyms | Source |
|---|---|
| 1α,25-dihydroxy-2β-(3-hydroxypropoxy)cholecalciferol | LIPID MAPS |
| (5Z,7E)-(1R,2R,3R)-2-(3-hydroxypropoxy)-9,10-seco-5,7,10(19)-cholestatriene-1,3,25-triol | LIPID MAPS |
| Eldecalcitol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 1α,25-dihydroxy-2β-(3-hydroxypropoxy)-cholecalciferol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| LMST03020477 | LIPID MAPS |
| 5169 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7318752 | Reaxys |
| CAS:104121-92-8 | ChemIDplus |