EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14N4O5 |
| Net Charge | 0 |
| Average Mass | 270.245 |
| Monoisotopic Mass | 270.09642 |
| SMILES | N[C@@H](Cc1cncn1)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H14N4O5/c11-6(1-5-3-12-4-13-5)9(17)14-7(10(18)19)2-8(15)16/h3-4,6-7H,1-2,11H2,(H,12,13)(H,14,17)(H,15,16)(H,18,19)/t6-,7-/m0/s1 |
| InChIKey | MDCTVRUPVLZSPG-BQBZGAKWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| His-Asp (CHEBI:73925) has role metabolite (CHEBI:25212) |
| His-Asp (CHEBI:73925) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-histidyl-L-aspartic acid |
| Synonyms | Source |
|---|---|
| HD | ChEBI |
| Histidinyl-Aspartate | HMDB |
| histidylaspartate | ChEBI |
| histidylaspartic acid | ChEBI |
| L-His-L-Asp | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028881 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:689558 | Reaxys |