EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14N4O3 |
| Net Charge | 0 |
| Average Mass | 226.236 |
| Monoisotopic Mass | 226.10659 |
| SMILES | C[C@H](NC(=O)[C@@H](N)Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C9H14N4O3/c1-5(9(15)16)13-8(14)7(10)2-6-3-11-4-12-6/h3-5,7H,2,10H2,1H3,(H,11,12)(H,13,14)(H,15,16)/t5-,7-/m0/s1 |
| InChIKey | FRJIAZKQGSCKPQ-FSPLSTOPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| His-Ala (CHEBI:73924) has role metabolite (CHEBI:25212) |
| His-Ala (CHEBI:73924) is a dipeptide (CHEBI:46761) |
| His-Ala (CHEBI:73924) is tautomer of His-Ala zwitterion (CHEBI:133630) |
| Incoming Relation(s) |
| His-Ala zwitterion (CHEBI:133630) is tautomer of His-Ala (CHEBI:73924) |
| IUPAC Name |
|---|
| L-histidyl-L-alanine |
| Synonyms | Source |
|---|---|
| HA | ChEBI |
| Histidinoalanine | ChemIDplus |
| Histidinyl-Alanine | HMDB |
| histidylalanine | ChEBI |
| N-(2-Amino-2-carboxyethyl)histidine | ChemIDplus |
| L-His-L-Ala | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028878 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:89967 | Reaxys |
| CAS:16874-75-2 | ChemIDplus |
| Citations |
|---|