EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14N2O3 |
| Net Charge | 0 |
| Average Mass | 174.200 |
| Monoisotopic Mass | 174.10044 |
| SMILES | CC(C)[C@H](NC(=O)CN)C(=O)O |
| InChI | InChI=1S/C7H14N2O3/c1-4(2)6(7(11)12)9-5(10)3-8/h4,6H,3,8H2,1-2H3,(H,9,10)(H,11,12)/t6-/m0/s1 |
| InChIKey | STKYPAFSDFAEPH-LURJTMIESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (21886157) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gly-Val (CHEBI:73922) has role human metabolite (CHEBI:77746) |
| Gly-Val (CHEBI:73922) is a dipeptide (CHEBI:46761) |
| Synonyms | Source |
|---|---|
| glycylvaline | ChEBI |
| Glycyl-Valine | HMDB |
| Gly-L-Val | ChEBI |
| GV | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028854 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1725593 | Reaxys |
| CAS:1963-21-9 | ChemIDplus |
| Citations |
|---|