EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16N2O4 |
| Net Charge | 0 |
| Average Mass | 204.226 |
| Monoisotopic Mass | 204.11101 |
| SMILES | C[C@H](NCCC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C8H16N2O4/c1-5(7(11)12)10-4-2-3-6(9)8(13)14/h5-6,10H,2-4,9H2,1H3,(H,11,12)(H,13,14)/t5-,6-/m0/s1 |
| InChIKey | DEGCDQUOHKYOQM-WDSKDSINSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N5-(L-1-carboxyethyl)-L-ornithine (CHEBI:16770) is a L-ornithine derivative (CHEBI:21368) |
| N5-(L-1-carboxyethyl)-L-ornithine (CHEBI:16770) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| N5-(L-1-carboxyethyl)-L-ornithine (CHEBI:16770) is tautomer of N5-(L-1-carboxyethyl)-L-ornithine dizwitterion (CHEBI:57889) |
| Incoming Relation(s) |
| N5-(L-1-carboxyethyl)-L-ornithine dizwitterion (CHEBI:57889) is tautomer of N5-(L-1-carboxyethyl)-L-ornithine (CHEBI:16770) |
| IUPAC Name |
|---|
| N5-[(1S)-1-carboxyethyl]-L-ornithine |
| Synonym | Source |
|---|---|
| N5-(L-1-Carboxyethyl)-L-ornithine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C04210 | KEGG COMPOUND |