EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16N2O4 |
| Net Charge | 0 |
| Average Mass | 204.226 |
| Monoisotopic Mass | 204.11101 |
| SMILES | C[C@H]([NH2+]CCC[C@H]([NH3+])C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C8H16N2O4/c1-5(7(11)12)10-4-2-3-6(9)8(13)14/h5-6,10H,2-4,9H2,1H3,(H,11,12)(H,13,14)/t5-,6-/m0/s1 |
| InChIKey | DEGCDQUOHKYOQM-WDSKDSINSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N5-(L-1-carboxyethyl)-L-ornithine dizwitterion (CHEBI:57889) is a amino-acid zwitterion (CHEBI:35238) |
| N5-(L-1-carboxyethyl)-L-ornithine dizwitterion (CHEBI:57889) is tautomer of N5-(L-1-carboxyethyl)-L-ornithine (CHEBI:16770) |
| Incoming Relation(s) |
| N5-(L-1-carboxyethyl)-L-ornithine (CHEBI:16770) is tautomer of N5-(L-1-carboxyethyl)-L-ornithine dizwitterion (CHEBI:57889) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-5-{[(1S)-1-carboxylatoethyl]azaniumyl}pentanoate |
| Synonym | Source |
|---|---|
| N5-(L-1-carboxyethyl)-L-ornithine zwitterion | ChEBI |
| UniProt Name | Source |
|---|---|
| N5-[1(S)-1-carboxyethyl]-L-ornithine | UniProt |