EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23N3O4 |
| Net Charge | 0 |
| Average Mass | 369.421 |
| Monoisotopic Mass | 369.16886 |
| SMILES | NCC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H23N3O4/c21-13-18(24)22-16(11-14-7-3-1-4-8-14)19(25)23-17(20(26)27)12-15-9-5-2-6-10-15/h1-10,16-17H,11-13,21H2,(H,22,24)(H,23,25)(H,26,27)/t16-,17-/m0/s1 |
| InChIKey | FEUPVVCGQLNXNP-IRXDYDNUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gly-Phe-Phe (CHEBI:73915) has role metabolite (CHEBI:25212) |
| Gly-Phe-Phe (CHEBI:73915) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| glycyl-L-phenylalanyl-L-phenylalanine |
| Synonyms | Source |
|---|---|
| GFF | ChEBI |
| glycylphenylalanylphenylalanine | ChEBI |
| Gly-L-Phe-L-Phe | ChEBI |
| N-(N-Glycyl-3-phenyl-L-alanyl)-3-phenyl-L-alanine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2785150 | Reaxys |
| CAS:13116-21-7 | ChemIDplus |