EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H17N3O3 |
| Net Charge | 0 |
| Average Mass | 203.242 |
| Monoisotopic Mass | 203.12699 |
| SMILES | NCCCC[C@H](NC(=O)CN)C(=O)O |
| InChI | InChI=1S/C8H17N3O3/c9-4-2-1-3-6(8(13)14)11-7(12)5-10/h6H,1-5,9-10H2,(H,11,12)(H,13,14)/t6-/m0/s1 |
| InChIKey | IKAIKUBBJHFNBZ-LURJTMIESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gly-Lys (CHEBI:73909) has role metabolite (CHEBI:25212) |
| Gly-Lys (CHEBI:73909) is a dipeptide (CHEBI:46761) |
| Gly-Lys (CHEBI:73909) is conjugate base of Gly-Lys(1+) (CHEBI:194323) |
| Incoming Relation(s) |
| Gly-Lys(1+) (CHEBI:194323) is conjugate acid of Gly-Lys (CHEBI:73909) |
| IUPAC Name |
|---|
| glycyl-L-lysine |
| Synonyms | Source |
|---|---|
| glycyllysine | ChEBI |
| Gly-L-Lys | ChEBI |
| GK | ChEBI |
| Glycyl-Lysine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028846 | HMDB |
| Citations |
|---|